![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| AI-Full Paper.pdf | 04-Aug-2009 16:19 | 281K | |
| AI-original.pdf | 04-Aug-2009 16:19 | 133K | |
| Angew, Quinone imides.pdf | 04-Aug-2009 16:19 | 130K | |
| Angewandte quinone imide.pdf | 27-Oct-2006 14:56 | 436K | |
| Aspartic Acid OrgLett.pdf | 04-Aug-2009 16:19 | 56K | |
| Aziridines.pdf | 04-Aug-2009 16:19 | 71K | |
| Bicarbonate.pdf | 04-Aug-2009 16:19 | 33K | |
| Bifu Cat Lewis acid base.pdf | 16-Apr-2008 14:17 | 453K | |
| Bifunc Paper OrgLett.pdf | 04-Aug-2009 16:19 | 115K | |
| Bifunctional Catalysis Lewis acid and base.pdf | 16-Apr-2008 14:17 | 453K | |
| CAC-CAEJ.pdf | 04-Aug-2009 16:19 | 274K | |
| CAC Full.pdf | 04-Aug-2009 16:19 | 177K | |
| Calculation Paper.pdf | 04-Aug-2009 16:19 | 2.2M | |
| Carbamates.pdf | 04-Aug-2009 16:19 | 50K | |
| Carbonate.pdf | 04-Aug-2009 16:19 | 47K | |
| Cobalt.pdf | 04-Aug-2009 16:19 | 48K | |
| Cu II-AI.pdf | 04-Aug-2009 16:19 | 141K | |
| Cyclophane.pdf | 04-Aug-2009 16:19 | 128K | |
| Fluorine Paper.pdf | 04-Aug-2009 16:19 | 68K | |
| FullAspartic.pdf | 04-Aug-2009 16:19 | 176K | |
| FullChloro.pdf | 04-Aug-2009 16:19 | 295K | |
| Imine-Enant.pdf | 04-Aug-2009 16:19 | 57K | |
| Imine Accounts.pdf | 04-Aug-2009 16:19 | 306K | |
| Iminoester Full.pdf | 04-Aug-2009 16:19 | 167K | |
| JACS diimide.pdf | 04-Aug-2009 16:19 | 61K | |
| JOC NP paper.pdf | 15-Feb-2010 09:49 | 927K | |
| JOC NP paper asap.pdf | 29-Dec-2009 14:22 | 922K | |
| JOC Note 2006.pdf | 04-Aug-2009 16:19 | 830K | |
| JOCNote2006.pdf | 27-Oct-2006 14:57 | 833K | |
| JOC_QI_support.pdf | 03-Oct-2008 12:07 | 5.0M | |
| JOC_QI metals.pdf | 04-Aug-2009 16:19 | 81K | |
| Lactam Accounts.pdf | 04-Aug-2009 16:19 | 295K | |
| Lactam Full.pdf | 04-Aug-2009 16:19 | 302K | |
| N,O-Acetals.pdf | 04-Aug-2009 16:19 | 70K | |
| NaH.pdf | 04-Aug-2009 16:19 | 46K | |
| Nuc-AI.pdf | 04-Aug-2009 16:19 | 80K | |
| Original CAC.pdf | 04-Aug-2009 16:19 | 94K | |
| Original Halo Paper.pdf | 04-Aug-2009 16:19 | 48K | |
| Original Lactam.pdf | 04-Aug-2009 16:19 | 45K | |
| Pages from Z602801e.rtf | 04-Aug-2009 16:19 | 28K | |
| Pubs.html | 22-Nov-2011 11:23 | 38K | |
| Pubs2.html | 04-Aug-2009 16:19 | 49K | |
| Sponge-AI H20.pdf | 04-Aug-2009 16:19 | 52K | |
| Sponge AI.pdf | 04-Aug-2009 16:19 | 106K | |
| Synthesis Machine.pdf | 04-Aug-2009 16:20 | 103K | |
| Trans Lactam Letter.pdf | 04-Aug-2009 16:20 | 67K | |
| a-fluorination.pdf | 27-Jan-2009 13:50 | 510K | |
| accounts%20paper%20print.pdf | 22-May-2008 16:47 | 453K | |
| acetals.pdf | 04-Aug-2009 16:19 | 837K | |
| bernstein paper.pdf | 04-Aug-2009 16:19 | 119K | |
| betalactam.pdf | 04-Aug-2009 16:19 | 92K | |
| bifun_lewis.pdf | 04-Aug-2009 16:19 | 453K | |
| chemia paper.pdf | 04-Aug-2009 16:19 | 405K | |
| chemreviews.pdf | 04-Aug-2009 16:19 | 786K | |
| coop lewis acid-base systems.pdf | 03-Oct-2008 11:32 | 453K | |
| difluorination.pdf | 13-Oct-2011 16:50 | 1.0M | |
| eruJOC CJ.pdf | 04-Aug-2009 16:19 | 252K | |
| fluorination1.pdf | 04-Aug-2009 16:19 | 510K | |
| halogenation review | 04-Aug-2009 16:19 | 133K | |
| imine-diastereo.pdf | 04-Aug-2009 16:19 | 67K | |
| imine-ene.pdf | 04-Aug-2009 16:19 | 84K | |
| intramol-AI.pdf | 04-Aug-2009 16:19 | 144K | |
| lactamaccounts.pdf | 26-Mar-2005 16:06 | 294K | |
| mech_switch.pdf | 04-Aug-2009 16:19 | 3.1M | |
| mechanistic bifunctional.pdf | 04-Aug-2009 16:19 | 267K | |
| mechinsight.pdf | 04-Aug-2009 16:19 | 350K | |
| mech insights inhib.pdf | 16-Apr-2008 17:39 | 350K | |
| mech insights into the inhibition of prostrate.pdf | 03-Oct-2008 11:28 | 350K | |
| mechswitch.pdf | 23-Jun-2009 21:03 | 3.0M | |
| o-Quinone comm.pdf | 04-Aug-2009 16:19 | 69K | |
| oquinonemeth-support.pdf | 04-Aug-2009 16:19 | 2.5M | |
| oquinonemeth.pdf | 04-Aug-2009 16:19 | 421K | |
| proton sponge.pdf | 04-Aug-2009 16:19 | 105K | |
| scerba h bond f.pdf | 13-Oct-2011 16:50 | 3.8M | |
| sdarticle.pdf | 18-Aug-2009 18:47 | 2.9M | |
| supporting/ | 03-Oct-2008 15:16 | - | |
| trifunctional fluorination.pdf | 30-Apr-2011 14:23 | 3.5M | |